C15H20FN — CID 90910284
10-ethyl-4-fluoro-7-methyl-2,3,6,7,8,9-hexahydropyrido[1,2-a]indole (PubChem CID 90910284) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is 10-ethyl-4-fluoro-7-methyl-2,3,6,7,8,9-hexahydropyrido[1,2-a]indole.
| Compound Name | 10-ethyl-4-fluoro-7-methyl-2,3,6,7,8,9-hexahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 90910284 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 10-ethyl-4-fluoro-7-methyl-2,3,6,7,8,9-hexahydropyrido[1,2-a]indole |
| SMILES | CCc1c2n(c3c1=CCCC=3F)CC(C)CC2 |
| InChI | InChI=1S/C15H20FN/c1-3-11-12-5-4-6-13(16)15(12)17-9-10(2)7-8-14(11)17/h5,10H,3-4,6-9H2,1-2H3 |
| InChIKey | CZTPKJNAFVYENG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |