C11H19N — CID 91711582
1-[(1E)-4-methylpenta-1,3-dienyl]piperidine (PubChem CID 91711582) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-[(1E)-4-methylpenta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1E)-4-methylpenta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 91711582 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-[(1E)-4-methylpenta-1,3-dienyl]piperidine |
| SMILES | CC(C)=C/C=C/N1CCCCC1 |
| InChI | InChI=1S/C11H19N/c1-11(2)7-6-10-12-8-4-3-5-9-12/h6-7,10H,3-5,8-9H2,1-2H3/b10-6+ |
| InChIKey | MEKRXSSUVKSKIA-UXBLZVDNSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|