About 1-(4-methylpenta-1,3-dien-2-yl)piperidine
1-(4-methylpenta-1,3-dien-2-yl)piperidine (PubChem CID 12661921) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-(4-methylpenta-1,3-dien-2-yl)piperidine.
Molecular Properties
| Compound Name | 1-(4-methylpenta-1,3-dien-2-yl)piperidine |
| PubChem CID | 12661921 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-(4-methylpenta-1,3-dien-2-yl)piperidine |
| SMILES | C=C(C=C(C)C)N1CCCCC1 |
| InChI | InChI=1S/C11H19N/c1-10(2)9-11(3)12-7-5-4-6-8-12/h9H,3-8H2,1-2H3 |
| InChIKey | XFUNWAQJJCBPQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylpenta-1,3-dien-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpenta-1,3-dien-2-yl)piperidine?
The IUPAC name of 1-(4-methylpenta-1,3-dien-2-yl)piperidine (CID 12661921) is 1-(4-methylpenta-1,3-dien-2-yl)piperidine.
What is the SMILES notation for 1-(4-methylpenta-1,3-dien-2-yl)piperidine?
The canonical SMILES for 1-(4-methylpenta-1,3-dien-2-yl)piperidine is C=C(C=C(C)C)N1CCCCC1.
What is the InChIKey of 1-(4-methylpenta-1,3-dien-2-yl)piperidine?
The InChIKey is XFUNWAQJJCBPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-10(2)9-11(3)12-7-5-4-6-8-12/h9H,3-8H2,1-2H3.
What are the key properties of 1-(4-methylpenta-1,3-dien-2-yl)piperidine?
1-(4-methylpenta-1,3-dien-2-yl)piperidine has a molecular weight of 165.28 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpenta-1,3-dien-2-yl)piperidine is sourced from PubChem (CID 12661921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).