C14H32N4 — CID 145197806
ethane;N-methylmethanamine;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine (PubChem CID 145197806) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is ethane;N-methylmethanamine;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine.
| Compound Name | ethane;N-methylmethanamine;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145197806 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | ethane;N-methylmethanamine;(1E,3Z)-1-piperidin-1-ylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCCCC1.CC.CNC |
| InChI | InChI=1S/C10H19N3.C2H7N.C2H6/c1-9(11)5-6-10(12)13-7-3-2-4-8-13;1-3-2;1-2/h5-6H,2-4,7-8,11-12H2,1H3;3H,1-2H3;1-2H3/b9-5-,10-6+;; |
| InChIKey | DNJMLOKNCZZDQH-ONLMGNRDSA-N |
| XLogP | 2.00 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|