C20H21N3O4S — CID 134923644
4-[4-ethoxy-N-(thiophen-2-ylmethyl)anilino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde (PubChem CID 134923644) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[4-ethoxy-N-(thiophen-2-ylmethyl)anilino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde.
| Compound Name | 4-[4-ethoxy-N-(thiophen-2-ylmethyl)anilino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 134923644 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[4-ethoxy-N-(thiophen-2-ylmethyl)anilino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde |
| SMILES | CCOc1ccc(N(Cc2cccs2)c2c(C=O)c(=O)n(C)c(=O)n2C)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-4-27-15-9-7-14(8-10-15)23(12-16-6-5-11-28-16)18-17(13-24)19(25)22(3)20(26)21(18)2/h5-11,13H,4,12H2,1-3H3 |
| InChIKey | YZSUFPYNJPAKNB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|