C15H27N3S — CID 134923720
N-ethyl-3,3-di(piperidin-1-yl)prop-2-enethioamide (PubChem CID 134923720) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is N-ethyl-3,3-di(piperidin-1-yl)prop-2-enethioamide.
| Compound Name | N-ethyl-3,3-di(piperidin-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 134923720 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-ethyl-3,3-di(piperidin-1-yl)prop-2-enethioamide |
| SMILES | CCNC(=S)C=C(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C15H27N3S/c1-2-16-14(19)13-15(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h13H,2-12H2,1H3,(H,16,19) |
| InChIKey | GSJBVQOSOBNPQQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|