C23H32O8 — CID 134924434
dimethyl 7,9-ditert-butyl-2,2-dimethoxy-6-oxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate (PubChem CID 134924434) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is dimethyl 7,9-ditert-butyl-2,2-dimethoxy-6-oxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate.
| Compound Name | dimethyl 7,9-ditert-butyl-2,2-dimethoxy-6-oxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134924434 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | dimethyl 7,9-ditert-butyl-2,2-dimethoxy-6-oxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C=C(C(C)(C)C)C=C(C(C)(C)C)C2=O)OC1(OC)OC |
| InChI | InChI=1S/C23H32O8/c1-20(2,3)13-11-14(21(4,5)6)17(24)22(12-13)15(18(25)27-7)16(19(26)28-8)23(29-9,30-10)31-22/h11-12H,1-10H3 |
| InChIKey | QPFWKBXPQSZFDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|