C30H37NO7 — CID 134924667
dimethyl (2S,5R,6R)-3-benzyl-7-oxo-8,17-dioxa-3-azatricyclo[16.2.2.02,6]docosa-1(20),18,21-triene-4,5-dicarboxylate (PubChem CID 134924667) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is dimethyl (2S,5R,6R)-3-benzyl-7-oxo-8,17-dioxa-3-azatricyclo[16.2.2.02,6]docosa-1(20),18,21-triene-4,5-dicarboxylate.
| Compound Name | dimethyl (2S,5R,6R)-3-benzyl-7-oxo-8,17-dioxa-3-azatricyclo[16.2.2.02,6]docosa-1(20),18,21-triene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134924667 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | dimethyl (2S,5R,6R)-3-benzyl-7-oxo-8,17-dioxa-3-azatricyclo[16.2.2.02,6]docosa-1(20),18,21-triene-4,5-dicarboxylate |
| SMILES | COC(=O)C1[C@H](C(=O)OC)[C@H]2C(=O)OCCCCCCCCOc3ccc(cc3)[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C30H37NO7/c1-35-28(32)25-24-26(31(27(25)30(34)36-2)20-21-12-8-7-9-13-21)22-14-16-23(17-15-22)37-18-10-5-3-4-6-11-19-38-29(24)33/h7-9,12-17,24-27H,3-6,10-11,18-20H2,1-2H3/t24-,25-,26-,27?/m1/s1 |
| InChIKey | BNTSZIZZSCNYAH-YGENNMJRSA-N |
| XLogP | 4.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|