C24H27NO6 — CID 102326618
diethyl (3S,4R,5S)-4-formyl-3-(4-methoxyphenyl)-5-phenylpyrrolidine-2,2-dicarboxylate (PubChem CID 102326618) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is diethyl (3S,4R,5S)-4-formyl-3-(4-methoxyphenyl)-5-phenylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,4R,5S)-4-formyl-3-(4-methoxyphenyl)-5-phenylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102326618 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | diethyl (3S,4R,5S)-4-formyl-3-(4-methoxyphenyl)-5-phenylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccccc2)[C@H](C=O)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-4-30-22(27)24(23(28)31-5-2)20(16-11-13-18(29-3)14-12-16)19(15-26)21(25-24)17-9-7-6-8-10-17/h6-15,19-21,25H,4-5H2,1-3H3/t19-,20-,21-/m1/s1 |
| InChIKey | FKELDNFRZLUNAH-NJDAHSKKSA-N |
| XLogP | 2.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|