C18H21NO5 — CID 134925326
methyl (3R,7aR)-3-tert-butyl-5,7-dioxo-6-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 134925326) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl (3R,7aR)-3-tert-butyl-5,7-dioxo-6-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,7aR)-3-tert-butyl-5,7-dioxo-6-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 134925326 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl (3R,7aR)-3-tert-butyl-5,7-dioxo-6-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)C(c1ccccc1)C2=O |
| InChI | InChI=1S/C18H21NO5/c1-17(2,3)15-19-14(21)12(11-8-6-5-7-9-11)13(20)18(19,10-24-15)16(22)23-4/h5-9,12,15H,10H2,1-4H3/t12?,15-,18-/m1/s1 |
| InChIKey | FQMUFWMFYWQTKL-MRHJZYCDSA-N |
| XLogP | 1.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|