C22H27NO5 — CID 25105029
methyl (3R,6R,7aR)-3-tert-butyl-6-methyl-5,7-dioxo-6-[(E)-3-phenylprop-2-enyl]-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 25105029) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl (3R,6R,7aR)-3-tert-butyl-6-methyl-5,7-dioxo-6-[(E)-3-phenylprop-2-enyl]-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,6R,7aR)-3-tert-butyl-6-methyl-5,7-dioxo-6-[(E)-3-phenylprop-2-enyl]-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 25105029 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | methyl (3R,6R,7aR)-3-tert-butyl-6-methyl-5,7-dioxo-6-[(E)-3-phenylprop-2-enyl]-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@](C)(C/C=C/c1ccccc1)C2=O |
| InChI | InChI=1S/C22H27NO5/c1-20(2,3)18-23-17(25)21(4,13-9-12-15-10-7-6-8-11-15)16(24)22(23,14-28-18)19(26)27-5/h6-12,18H,13-14H2,1-5H3/b12-9+/t18-,21-,22-/m1/s1 |
| InChIKey | KRLHPSBCCGSZKN-NNDWJTBZSA-N |
| XLogP | 2.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|