C17H21NO4 — CID 154709211
methyl (3R,7R,7aS)-5-oxo-7-phenyl-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 154709211) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl (3R,7R,7aS)-5-oxo-7-phenyl-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,7R,7aS)-5-oxo-7-phenyl-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 154709211 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl (3R,7R,7aS)-5-oxo-7-phenyl-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)C)N1C(=O)C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-11(2)15-18-14(19)9-13(12-7-5-4-6-8-12)17(18,10-22-15)16(20)21-3/h4-8,11,13,15H,9-10H2,1-3H3/t13-,15-,17-/m1/s1 |
| InChIKey | XGKVMZIPXBDTCY-FRFSOERESA-N |
| XLogP | 1.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |