C21H26N2O6 — CID 134953949
diethyl (1R,3S,3aR,6aS)-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate (PubChem CID 134953949) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is diethyl (1R,3S,3aR,6aS)-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate.
| Compound Name | diethyl (1R,3S,3aR,6aS)-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134953949 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | diethyl (1R,3S,3aR,6aS)-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@](Cc2ccccc2)(C(=O)OCC)[C@@H]2C(=O)N(CC)C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H26N2O6/c1-4-23-17(24)14-15(18(23)25)21(20(27)29-6-3,12-13-10-8-7-9-11-13)22-16(14)19(26)28-5-2/h7-11,14-16,22H,4-6,12H2,1-3H3/t14-,15-,16+,21-/m0/s1 |
| InChIKey | FRXWZYBVGCUKEL-CMBDLQSPSA-N |
| XLogP | 0.69 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|