C20H24N2O6 — CID 71518769
diethyl (1R,3S,3aR,6aS)-3-benzyl-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate (PubChem CID 71518769) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is diethyl (1R,3S,3aR,6aS)-3-benzyl-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate.
| Compound Name | diethyl (1R,3S,3aR,6aS)-3-benzyl-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71518769 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | diethyl (1R,3S,3aR,6aS)-3-benzyl-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@](Cc2ccccc2)(C(=O)OCC)[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C20H24N2O6/c1-4-27-18(25)15-13-14(17(24)22(3)16(13)23)20(21-15,19(26)28-5-2)11-12-9-7-6-8-10-12/h6-10,13-15,21H,4-5,11H2,1-3H3/t13-,14-,15+,20-/m0/s1 |
| InChIKey | MOIRVVTYNKIZDE-CJXDPKRBSA-N |
| XLogP | 0.30 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|