C22H30N2O6 — CID 134925340
tert-butyl (4R)-4-[4-[benzyl(hydroxy)amino]pent-2-ynoyloxy]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134925340) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl (4R)-4-[4-[benzyl(hydroxy)amino]pent-2-ynoyloxy]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[4-[benzyl(hydroxy)amino]pent-2-ynoyloxy]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134925340 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | tert-butyl (4R)-4-[4-[benzyl(hydroxy)amino]pent-2-ynoyloxy]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C#CC(=O)O[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H30N2O6/c1-16(23(27)14-17-10-8-7-9-11-17)12-13-19(25)29-18-15-28-22(5,6)24(18)20(26)30-21(2,3)4/h7-11,16,18,27H,14-15H2,1-6H3/t16?,18-/m1/s1 |
| InChIKey | RNGSGORCCQAMOE-UHUGOGIASA-N |
| XLogP | 3.14 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|