C18H28O3 — CID 134925370
2,4-ditert-butyl-6-hydroxy-5-methoxy-6-prop-2-enylcyclohexa-2,4-dien-1-one (PubChem CID 134925370) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-hydroxy-5-methoxy-6-prop-2-enylcyclohexa-2,4-dien-1-one.
| Compound Name | 2,4-ditert-butyl-6-hydroxy-5-methoxy-6-prop-2-enylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 134925370 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2,4-ditert-butyl-6-hydroxy-5-methoxy-6-prop-2-enylcyclohexa-2,4-dien-1-one |
| SMILES | C=CCC1(O)C(=O)C(C(C)(C)C)=CC(C(C)(C)C)=C1OC |
| InChI | InChI=1S/C18H28O3/c1-9-10-18(20)14(19)12(16(2,3)4)11-13(15(18)21-8)17(5,6)7/h9,11,20H,1,10H2,2-8H3 |
| InChIKey | CBLREPFBHOTRLR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|