C10H12O3 — CID 10607455
2-ethenyl-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one (PubChem CID 10607455) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-ethenyl-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one.
| Compound Name | 2-ethenyl-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10607455 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-ethenyl-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one |
| SMILES | C=CCC1(O)C(=O)C(C=C)=C1OC |
| InChI | InChI=1S/C10H12O3/c1-4-6-10(12)8(11)7(5-2)9(10)13-3/h4-5,12H,1-2,6H2,3H3 |
| InChIKey | MPGZLIMVULWURC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|