C13H18O3Si — CID 15701463
4-hydroxy-3-methoxy-4-prop-2-enyl-2-(2-trimethylsilylethynyl)cyclobut-2-en-1-one (PubChem CID 15701463) has the molecular formula C13H18O3Si and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-hydroxy-3-methoxy-4-prop-2-enyl-2-(2-trimethylsilylethynyl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-3-methoxy-4-prop-2-enyl-2-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15701463 |
| Molecular Formula | C13H18O3Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-hydroxy-3-methoxy-4-prop-2-enyl-2-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
| SMILES | C=CCC1(O)C(=O)C(C#C[Si](C)(C)C)=C1OC |
| InChI | InChI=1S/C13H18O3Si/c1-6-8-13(15)11(14)10(12(13)16-2)7-9-17(3,4)5/h6,15H,1,8H2,2-5H3 |
| InChIKey | GGPSOSFZAMZZNM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|