C21H34O4Si — CID 10643394
4-[(5R)-5,9-dimethyl-3-trimethylsilyldec-8-en-1-ynyl]-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 10643394) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is 4-[(5R)-5,9-dimethyl-3-trimethylsilyldec-8-en-1-ynyl]-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-[(5R)-5,9-dimethyl-3-trimethylsilyldec-8-en-1-ynyl]-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10643394 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-[(5R)-5,9-dimethyl-3-trimethylsilyldec-8-en-1-ynyl]-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | COC1=C(OC)C(O)(C#CC(C[C@H](C)CCC=C(C)C)[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C21H34O4Si/c1-15(2)10-9-11-16(3)14-17(26(6,7)8)12-13-21(23)19(22)18(24-4)20(21)25-5/h10,16-17,23H,9,11,14H2,1-8H3/t16-,17?,21?/m1/s1 |
| InChIKey | BLZFKYAJATWAJA-ZGGTZUKQSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|