C16H22O4Si — CID 10590797
4-hydroxy-2,3-dimethoxy-4-(5-methyl-1-trimethylsilylhexa-3,4-dien-1-yn-3-yl)cyclobut-2-en-1-one (PubChem CID 10590797) has the molecular formula C16H22O4Si and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-4-(5-methyl-1-trimethylsilylhexa-3,4-dien-1-yn-3-yl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-dimethoxy-4-(5-methyl-1-trimethylsilylhexa-3,4-dien-1-yn-3-yl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10590797 |
| Molecular Formula | C16H22O4Si |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4-hydroxy-2,3-dimethoxy-4-(5-methyl-1-trimethylsilylhexa-3,4-dien-1-yn-3-yl)cyclobut-2-en-1-one |
| SMILES | COC1=C(OC)C(O)(C(=C=C(C)C)C#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C16H22O4Si/c1-11(2)10-12(8-9-21(5,6)7)16(18)14(17)13(19-3)15(16)20-4/h18H,1-7H3 |
| InChIKey | VHKMLRUKNRVMJB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|