C19H34O5Si2 — CID 10668587
4-hydroxy-2,3-dimethoxy-4-[1-[(2-methylpropan-2-yl)oxy]-3,3-bis(trimethylsilyl)propa-1,2-dienyl]cyclobut-2-en-1-one (PubChem CID 10668587) has the molecular formula C19H34O5Si2 and a molecular weight of 398.65 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-4-[1-[(2-methylpropan-2-yl)oxy]-3,3-bis(trimethylsilyl)propa-1,2-dienyl]cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-dimethoxy-4-[1-[(2-methylpropan-2-yl)oxy]-3,3-bis(trimethylsilyl)propa-1,2-dienyl]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10668587 |
| Molecular Formula | C19H34O5Si2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-hydroxy-2,3-dimethoxy-4-[1-[(2-methylpropan-2-yl)oxy]-3,3-bis(trimethylsilyl)propa-1,2-dienyl]cyclobut-2-en-1-one |
| SMILES | COC1=C(OC)C(O)(C(=C=C([Si](C)(C)C)[Si](C)(C)C)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H34O5Si2/c1-18(2,3)24-13(12-14(25(6,7)8)26(9,10)11)19(21)16(20)15(22-4)17(19)23-5/h21H,1-11H3 |
| InChIKey | JUIDPRMVLMQBRH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|