C17H32O4Si — CID 14140288
4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one (PubChem CID 14140288) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14140288 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)C(C)(O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H32O4Si/c1-11(2)19-13-14(18)17(8,15(13)20-12(3)4)21-22(9,10)16(5,6)7/h11-12H,1-10H3 |
| InChIKey | ZQDZENAJDYOJKC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|