C16H26O5Si — CID 10592256
4-hydroxy-2,3-dimethoxy-4-(1-methoxy-3-trimethylsilylhexa-1,2-dienyl)cyclobut-2-en-1-one (PubChem CID 10592256) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-4-(1-methoxy-3-trimethylsilylhexa-1,2-dienyl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-dimethoxy-4-(1-methoxy-3-trimethylsilylhexa-1,2-dienyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10592256 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-hydroxy-2,3-dimethoxy-4-(1-methoxy-3-trimethylsilylhexa-1,2-dienyl)cyclobut-2-en-1-one |
| SMILES | CCCC(=C=C(OC)C1(O)C(=O)C(OC)=C1OC)[Si](C)(C)C |
| InChI | InChI=1S/C16H26O5Si/c1-8-9-11(22(5,6)7)10-12(19-2)16(18)14(17)13(20-3)15(16)21-4/h18H,8-9H2,1-7H3 |
| InChIKey | VOJDTLGZXTWMKG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|