About 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one
4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one (PubChem CID 10261343) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one.
Analyze 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one?
The IUPAC name of 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one (CID 10261343) is 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one.
What is the SMILES notation for 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one?
The canonical SMILES for 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one is COC1=C(OC)C(C)(O)C1=O.
What is the InChIKey of 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one?
The InChIKey is PTQMLCKHODRRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-7(9)5(8)4(10-2)6(7)11-3/h9H,1-3H3.
What are the key properties of 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one?
4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one has a molecular weight of 158.15 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethoxy-4-methylcyclobut-2-en-1-one is sourced from PubChem (CID 10261343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).