C15H24O4Si — CID 14140284
4-hydroxy-2,3-di(propan-2-yloxy)-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one (PubChem CID 14140284) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-hydroxy-2,3-di(propan-2-yloxy)-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14140284 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)C(O)(C#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C15H24O4Si/c1-10(2)18-12-13(16)15(17,8-9-20(5,6)7)14(12)19-11(3)4/h10-11,17H,1-7H3 |
| InChIKey | BIZSEJYCQSVKAM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|