C15H26O5Si2 — CID 13460297
2,3-dimethoxy-4-trimethylsilyloxy-4-(3-trimethylsilyloxyprop-1-ynyl)cyclobut-2-en-1-one (PubChem CID 13460297) has the molecular formula C15H26O5Si2 and a molecular weight of 342.54 g/mol. Its IUPAC name is 2,3-dimethoxy-4-trimethylsilyloxy-4-(3-trimethylsilyloxyprop-1-ynyl)cyclobut-2-en-1-one.
| Compound Name | 2,3-dimethoxy-4-trimethylsilyloxy-4-(3-trimethylsilyloxyprop-1-ynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 13460297 |
| Molecular Formula | C15H26O5Si2 |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,3-dimethoxy-4-trimethylsilyloxy-4-(3-trimethylsilyloxyprop-1-ynyl)cyclobut-2-en-1-one |
| SMILES | COC1=C(OC)C(C#CCO[Si](C)(C)C)(O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C15H26O5Si2/c1-17-12-13(16)15(14(12)18-2,20-22(6,7)8)10-9-11-19-21(3,4)5/h11H2,1-8H3 |
| InChIKey | UCMHJWKHKSVEEQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|