C15H20O4Si — CID 134876296
4-hexa-1,5-diynyl-2,3-dimethoxy-4-trimethylsilyloxycyclobut-2-en-1-one (PubChem CID 134876296) has the molecular formula C15H20O4Si and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-hexa-1,5-diynyl-2,3-dimethoxy-4-trimethylsilyloxycyclobut-2-en-1-one.
| Compound Name | 4-hexa-1,5-diynyl-2,3-dimethoxy-4-trimethylsilyloxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 134876296 |
| Molecular Formula | C15H20O4Si |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-hexa-1,5-diynyl-2,3-dimethoxy-4-trimethylsilyloxycyclobut-2-en-1-one |
| SMILES | C#CCCC#CC1(O[Si](C)(C)C)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C15H20O4Si/c1-7-8-9-10-11-15(19-20(4,5)6)13(16)12(17-2)14(15)18-3/h1H,8-9H2,2-6H3 |
| InChIKey | BAMSSYSBHXDIJF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|