C16H20O4 — CID 15004569
4-deca-1,5-diynyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 15004569) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-deca-1,5-diynyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-deca-1,5-diynyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15004569 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-deca-1,5-diynyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | CCCCC#CCCC#CC1(O)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C16H20O4/c1-4-5-6-7-8-9-10-11-12-16(18)14(17)13(19-2)15(16)20-3/h18H,4-6,9-10H2,1-3H3 |
| InChIKey | FYQGXTXOFGJKQD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|