C14H22O3Si — CID 14562980
4-hydroxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one (PubChem CID 14562980) has the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14562980 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-hydroxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
| SMILES | CC1=C(OC(C)(C)C)C(O)(C#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H22O3Si/c1-10-11(15)14(16,8-9-18(5,6)7)12(10)17-13(2,3)4/h16H,1-7H3 |
| InChIKey | RNUFBDHBCYRIQW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|