C15H32OSi — CID 13492542
tert-butyl-dimethyl-(3,3,5-trimethylcyclohexyl)oxysilane (PubChem CID 13492542) has the molecular formula C15H32OSi and a molecular weight of 256.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3,3,5-trimethylcyclohexyl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(3,3,5-trimethylcyclohexyl)oxysilane |
|---|---|
| PubChem CID | 13492542 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl-dimethyl-(3,3,5-trimethylcyclohexyl)oxysilane |
| SMILES | CC1CC(O[Si](C)(C)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H32OSi/c1-12-9-13(11-15(5,6)10-12)16-17(7,8)14(2,3)4/h12-13H,9-11H2,1-8H3 |
| InChIKey | JVSGPFILWCVGCG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|