C11H23ClOSi — CID 554802
chloromethyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane (PubChem CID 554802) has the molecular formula C11H23ClOSi and a molecular weight of 234.84 g/mol. Its IUPAC name is chloromethyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane.
| Compound Name | chloromethyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 554802 |
| Molecular Formula | C11H23ClOSi |
| Molecular Weight | 234.84 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | chloromethyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane |
| SMILES | CC1CC(C)CC(O[Si](C)(C)CCl)C1 |
| InChI | InChI=1S/C11H23ClOSi/c1-9-5-10(2)7-11(6-9)13-14(3,4)8-12/h9-11H,5-8H2,1-4H3 |
| InChIKey | HPWAZAWCBHEKNS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|