About 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane
3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane (PubChem CID 554584) has the molecular formula C13H27ClOSi
and a molecular weight of 262.90 g/mol. Its IUPAC name is 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane.
Molecular Properties
| Compound Name | 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane |
| PubChem CID | 554584 |
| Molecular Formula | C13H27ClOSi |
| Molecular Weight | 262.90 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane |
| SMILES | CC1CC(C)CC(O[Si](C)(C)CCCCl)C1 |
| InChI | InChI=1S/C13H27ClOSi/c1-11-8-12(2)10-13(9-11)15-16(3,4)7-5-6-14/h11-13H,5-10H2,1-4H3 |
| InChIKey | TWRYBQRLHOKQHK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane?
The IUPAC name of 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane (CID 554584) is 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane.
What is the SMILES notation for 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane?
The canonical SMILES for 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane is CC1CC(C)CC(O[Si](C)(C)CCCCl)C1.
What is the InChIKey of 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane?
The InChIKey is TWRYBQRLHOKQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27ClOSi/c1-11-8-12(2)10-13(9-11)15-16(3,4)7-5-6-14/h11-13H,5-10H2,1-4H3.
What are the key properties of 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane?
3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane has a molecular weight of 262.90 g/mol, XLogP of 4.66, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl-(3,5-dimethylcyclohexyl)oxy-dimethylsilane is sourced from PubChem (CID 554584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).