C14H29OSi — CID 6329055
3,5-Dimethyl-1-diisopropylsilyloxycyclohexane (PubChem CID 6329055) has the molecular formula C14H29OSi and a molecular weight of 241.47 g/mol.
| Compound Name | 3,5-Dimethyl-1-diisopropylsilyloxycyclohexane |
|---|---|
| PubChem CID | 6329055 |
| Molecular Formula | C14H29OSi |
| Molecular Weight | 241.47 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | — |
| SMILES | CC1CC(C)CC(O[Si](C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C14H29OSi/c1-10(2)16(11(3)4)15-14-8-12(5)7-13(6)9-14/h10-14H,7-9H2,1-6H3 |
| InChIKey | HZOURIOMTOMYOB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|