C10H21OSi — CID 6329361
[(3,5-Dimethylcyclohexyl)oxy](dimethyl)silane (PubChem CID 6329361) has the molecular formula C10H21OSi and a molecular weight of 185.36 g/mol.
| Compound Name | [(3,5-Dimethylcyclohexyl)oxy](dimethyl)silane |
|---|---|
| PubChem CID | 6329361 |
| Molecular Formula | C10H21OSi |
| Molecular Weight | 185.36 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | — |
| SMILES | CC1CC(C)CC(O[Si](C)C)C1 |
| InChI | InChI=1S/C10H21OSi/c1-8-5-9(2)7-10(6-8)11-12(3)4/h8-10H,5-7H2,1-4H3 |
| InChIKey | MOEDOPCNSBYTCW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|