C21H19ClN2O6S — CID 134925468
(4-nitrophenyl) (2R)-2-chloro-2-[(3S,4R)-3-ethyl-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-oxobutanoate (PubChem CID 134925468) has the molecular formula C21H19ClN2O6S and a molecular weight of 462.91 g/mol. Its IUPAC name is (4-nitrophenyl) (2R)-2-chloro-2-[(3S,4R)-3-ethyl-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-oxobutanoate.
| Compound Name | (4-nitrophenyl) (2R)-2-chloro-2-[(3S,4R)-3-ethyl-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 134925468 |
| Molecular Formula | C21H19ClN2O6S |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | (4-nitrophenyl) (2R)-2-chloro-2-[(3S,4R)-3-ethyl-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-oxobutanoate |
| SMILES | CC[C@H]1C(=O)N([C@@](Cl)(C(C)=O)C(=O)Oc2ccc([N+](=O)[O-])cc2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C21H19ClN2O6S/c1-3-17-18(26)23(19(17)31-16-7-5-4-6-8-16)21(22,13(2)25)20(27)30-15-11-9-14(10-12-15)24(28)29/h4-12,17,19H,3H2,1-2H3/t17-,19+,21-/m0/s1 |
| InChIKey | CWDOGWYYQMFCSM-DSKINZAPSA-N |
| XLogP | 4.01 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|