C19H28N2O5 — CID 134925540
1-O-ethyl 4-O-methyl 2-benzyl-5-butoxypyrazolidine-1,4-dicarboxylate (PubChem CID 134925540) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-benzyl-5-butoxypyrazolidine-1,4-dicarboxylate.
| Compound Name | 1-O-ethyl 4-O-methyl 2-benzyl-5-butoxypyrazolidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134925540 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-benzyl-5-butoxypyrazolidine-1,4-dicarboxylate |
| SMILES | CCCCOC1C(C(=O)OC)CN(Cc2ccccc2)N1C(=O)OCC |
| InChI | InChI=1S/C19H28N2O5/c1-4-6-12-26-17-16(18(22)24-3)14-20(21(17)19(23)25-5-2)13-15-10-8-7-9-11-15/h7-11,16-17H,4-6,12-14H2,1-3H3 |
| InChIKey | YEGYNOIYMDHUJU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|