C17H22N2O6 — CID 134925541
1-O-ethyl 4-O,5-O-dimethyl 2-benzylpyrazolidine-1,4,5-tricarboxylate (PubChem CID 134925541) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-O-ethyl 4-O,5-O-dimethyl 2-benzylpyrazolidine-1,4,5-tricarboxylate.
| Compound Name | 1-O-ethyl 4-O,5-O-dimethyl 2-benzylpyrazolidine-1,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134925541 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-O-ethyl 4-O,5-O-dimethyl 2-benzylpyrazolidine-1,4,5-tricarboxylate |
| SMILES | CCOC(=O)N1C(C(=O)OC)C(C(=O)OC)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O6/c1-4-25-17(22)19-14(16(21)24-3)13(15(20)23-2)11-18(19)10-12-8-6-5-7-9-12/h5-9,13-14H,4,10-11H2,1-3H3 |
| InChIKey | QOGHDDJLYFAZTF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|