C29H39NO5 — CID 134925893
(1S,2S)-N-benzyl-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine (PubChem CID 134925893) has the molecular formula C29H39NO5 and a molecular weight of 481.63 g/mol. Its IUPAC name is (1S,2S)-N-benzyl-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine.
| Compound Name | (1S,2S)-N-benzyl-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine |
|---|---|
| PubChem CID | 134925893 |
| Molecular Formula | C29H39NO5 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | (1S,2S)-N-benzyl-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine |
| SMILES | C=CC[C@H](NCc1ccccc1)[C@H](OCc1ccccc1)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C29H39NO5/c1-6-13-23(30-18-21-14-9-7-10-15-21)25(31-19-22-16-11-8-12-17-22)27-26(34-29(4,5)35-27)24-20-32-28(2,3)33-24/h6-12,14-17,23-27,30H,1,13,18-20H2,2-5H3/t23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | JPEAAOYZGNUBEE-XQDVFQCSSA-N |
| XLogP | 4.98 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|