C19H27NO6 — CID 134926009
N-[(3aS,4R,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-benzylhydroxylamine (PubChem CID 134926009) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(3aS,4R,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-benzylhydroxylamine.
| Compound Name | N-[(3aS,4R,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-benzylhydroxylamine |
|---|---|
| PubChem CID | 134926009 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[(3aS,4R,6R,6aS)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-benzylhydroxylamine |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H]3COC(C)(C)O3)O[C@@H](N(O)Cc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H27NO6/c1-18(2)22-11-13(24-18)14-15-16(26-19(3,4)25-15)17(23-14)20(21)10-12-8-6-5-7-9-12/h5-9,13-17,21H,10-11H2,1-4H3/t13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | BKHQNJCZCGXQHB-BQJWPVKWSA-N |
| XLogP | 2.27 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|