C24H41NO7 — CID 134926010
N-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4S)-6-methyl-1-[(2-methylpropan-2-yl)oxy]hept-2-yn-4-yl]hydroxylamine (PubChem CID 134926010) has the molecular formula C24H41NO7 and a molecular weight of 455.59 g/mol. Its IUPAC name is N-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4S)-6-methyl-1-[(2-methylpropan-2-yl)oxy]hept-2-yn-4-yl]hydroxylamine.
| Compound Name | N-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4S)-6-methyl-1-[(2-methylpropan-2-yl)oxy]hept-2-yn-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 134926010 |
| Molecular Formula | C24H41NO7 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | N-[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4S)-6-methyl-1-[(2-methylpropan-2-yl)oxy]hept-2-yn-4-yl]hydroxylamine |
| SMILES | CC(C)C[C@@H](C#CCOC(C)(C)C)N(O)[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C24H41NO7/c1-15(2)13-16(11-10-12-27-22(3,4)5)25(26)21-20-19(31-24(8,9)32-20)18(29-21)17-14-28-23(6,7)30-17/h15-21,26H,12-14H2,1-9H3/t16-,17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | GVLVGCQDUQEPNG-COXXTLHVSA-N |
| XLogP | 3.31 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|