C22H29NO6S — CID 10863020
N-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(1R)-1-(1-benzothiophen-2-yl)ethyl]hydroxylamine (PubChem CID 10863020) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is N-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(1R)-1-(1-benzothiophen-2-yl)ethyl]hydroxylamine.
| Compound Name | N-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(1R)-1-(1-benzothiophen-2-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 10863020 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(1R)-1-(1-benzothiophen-2-yl)ethyl]hydroxylamine |
| SMILES | C[C@H](c1cc2ccccc2s1)N(O)[C@@H]1O[C@@H]([C@H]2COC(C)(C)O2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H29NO6S/c1-12(16-10-13-8-6-7-9-15(13)30-16)23(24)20-19-18(28-22(4,5)29-19)17(26-20)14-11-25-21(2,3)27-14/h6-10,12,14,17-20,24H,11H2,1-5H3/t12-,14-,17+,18-,19-,20-/m1/s1 |
| InChIKey | UHOLZDFERHNIAT-CKJGZRAFSA-N |
| XLogP | 4.05 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|