C11H13KN2O2S — CID 173208047
potassium;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea;hydride (PubChem CID 173208047) has the molecular formula C11H13KN2O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is potassium;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea;hydride.
| Compound Name | potassium;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea;hydride |
|---|---|
| PubChem CID | 173208047 |
| Molecular Formula | C11H13KN2O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | potassium;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea;hydride |
| SMILES | CC(c1cc2ccccc2s1)N(O)C(N)=O.[H-].[K+] |
| InChI | InChI=1S/C11H12N2O2S.K.H/c1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10;;/h2-7,15H,1H3,(H2,12,14);;/q;+1;-1 |
| InChIKey | BCAKHZXFEKNPMW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|