C20H20N2O4S — CID 10691423
[[(1R)-1-(1-benzothiophen-2-yl)ethyl]-carbamoylamino] (2R)-2-methoxy-2-phenylacetate (PubChem CID 10691423) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is [[(1R)-1-(1-benzothiophen-2-yl)ethyl]-carbamoylamino] (2R)-2-methoxy-2-phenylacetate.
| Compound Name | [[(1R)-1-(1-benzothiophen-2-yl)ethyl]-carbamoylamino] (2R)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 10691423 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [[(1R)-1-(1-benzothiophen-2-yl)ethyl]-carbamoylamino] (2R)-2-methoxy-2-phenylacetate |
| SMILES | CO[C@@H](C(=O)ON(C(N)=O)[C@H](C)c1cc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-13(17-12-15-10-6-7-11-16(15)27-17)22(20(21)24)26-19(23)18(25-2)14-8-4-3-5-9-14/h3-13,18H,1-2H3,(H2,21,24)/t13-,18-/m1/s1 |
| InChIKey | OMCFOCDJHGTOGY-FZKQIMNGSA-N |
| XLogP | 4.19 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|