C26H26N2O4S — CID 22408563
[1-(1-benzothiophen-2-yl)ethyl-(methylcarbamoyl)amino] 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 22408563) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is [1-(1-benzothiophen-2-yl)ethyl-(methylcarbamoyl)amino] 2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [1-(1-benzothiophen-2-yl)ethyl-(methylcarbamoyl)amino] 2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 22408563 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [1-(1-benzothiophen-2-yl)ethyl-(methylcarbamoyl)amino] 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | CNC(=O)N(OC(=O)C(C)c1ccc2cc(OC)ccc2c1)C(C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C26H26N2O4S/c1-16(18-9-10-20-14-22(31-4)12-11-19(20)13-18)25(29)32-28(26(30)27-3)17(2)24-15-21-7-5-6-8-23(21)33-24/h5-17H,1-4H3,(H,27,30) |
| InChIKey | MRRBDYRVMUKFGD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|