About [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate
[1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate (PubChem CID 22408547) has the molecular formula C24H26N2O4S
and a molecular weight of 438.55 g/mol. Its IUPAC name is [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate.
Molecular Properties
| Compound Name | [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate |
| PubChem CID | 22408547 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate |
| SMILES | CCC1Cc2cc(C(C)C(=O)ON(C(N)=O)C(C)c3cc4ccccc4s3)ccc2O1 |
| InChI | InChI=1S/C24H26N2O4S/c1-4-19-12-18-11-16(9-10-20(18)29-19)14(2)23(27)30-26(24(25)28)15(3)22-13-17-7-5-6-8-21(17)31-22/h5-11,13-15,19H,4,12H2,1-3H3,(H2,25,28) |
| InChIKey | ILLQMEUKESFJQO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate?
The IUPAC name of [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate (CID 22408547) is [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate.
What is the SMILES notation for [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate?
The canonical SMILES for [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate is CCC1Cc2cc(C(C)C(=O)ON(C(N)=O)C(C)c3cc4ccccc4s3)ccc2O1.
What is the InChIKey of [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate?
The InChIKey is ILLQMEUKESFJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4S/c1-4-19-12-18-11-16(9-10-20(18)29-19)14(2)23(27)30-26(24(25)28)15(3)22-13-17-7-5-6-8-21(17)31-22/h5-11,13-15,19H,4,12H2,1-3H3,(H2,25,28).
What are the key properties of [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate?
[1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate has a molecular weight of 438.55 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-benzothiophen-2-yl)ethyl-carbamoylamino] 2-(2-ethyl-2,3-dihydro-1-benzofuran-5-yl)propanoate is sourced from PubChem (CID 22408547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).