C23H25N3O4S2 — CID 158690379
N-[(1S)-1-(1-benzothiophen-2-yl)ethyl]-N-hydroxyacetamide;1-[(1R)-1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea (PubChem CID 158690379) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzothiophen-2-yl)ethyl]-N-hydroxyacetamide;1-[(1R)-1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea.
| Compound Name | N-[(1S)-1-(1-benzothiophen-2-yl)ethyl]-N-hydroxyacetamide;1-[(1R)-1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 158690379 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-[(1S)-1-(1-benzothiophen-2-yl)ethyl]-N-hydroxyacetamide;1-[(1R)-1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea |
| SMILES | CC(=O)N(O)[C@@H](C)c1cc2ccccc2s1.C[C@H](c1cc2ccccc2s1)N(O)C(N)=O |
| InChI | InChI=1S/C12H13NO2S.C11H12N2O2S/c1-8(13(15)9(2)14)12-7-10-5-3-4-6-11(10)16-12;1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h3-8,15H,1-2H3;2-7,15H,1H3,(H2,12,14)/t8-;7-/m01/s1 |
| InChIKey | IGGQWEHEMCMDQJ-FFHWYSLTSA-N |
| XLogP | 5.93 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|