C29H28N4O5S — CID 139448740
(2S)-4-[1-(1-benzothiophen-2-yl)ethyl-hydroxycarbamoyl]-1-(diphenylcarbamoyl)piperazine-2-carboxylic acid (PubChem CID 139448740) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is (2S)-4-[1-(1-benzothiophen-2-yl)ethyl-hydroxycarbamoyl]-1-(diphenylcarbamoyl)piperazine-2-carboxylic acid.
| Compound Name | (2S)-4-[1-(1-benzothiophen-2-yl)ethyl-hydroxycarbamoyl]-1-(diphenylcarbamoyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 139448740 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (2S)-4-[1-(1-benzothiophen-2-yl)ethyl-hydroxycarbamoyl]-1-(diphenylcarbamoyl)piperazine-2-carboxylic acid |
| SMILES | CC(c1cc2ccccc2s1)N(O)C(=O)N1CCN(C(=O)N(c2ccccc2)c2ccccc2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C29H28N4O5S/c1-20(26-18-21-10-8-9-15-25(21)39-26)33(38)28(36)30-16-17-31(24(19-30)27(34)35)29(37)32(22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-15,18,20,24,38H,16-17,19H2,1H3,(H,34,35)/t20?,24-/m0/s1 |
| InChIKey | GYPDFTHMUISADA-JWIMYKKASA-N |
| XLogP | 5.80 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|