C30H42N4O4 — CID 18965173
4-(dipentylcarbamoyl)-1-[(3-methylphenyl)-phenylcarbamoyl]piperazine-2-carboxylic acid (PubChem CID 18965173) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is 4-(dipentylcarbamoyl)-1-[(3-methylphenyl)-phenylcarbamoyl]piperazine-2-carboxylic acid.
| Compound Name | 4-(dipentylcarbamoyl)-1-[(3-methylphenyl)-phenylcarbamoyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 18965173 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 4-(dipentylcarbamoyl)-1-[(3-methylphenyl)-phenylcarbamoyl]piperazine-2-carboxylic acid |
| SMILES | CCCCCN(CCCCC)C(=O)N1CCN(C(=O)N(c2ccccc2)c2cccc(C)c2)C(C(=O)O)C1 |
| InChI | InChI=1S/C30H42N4O4/c1-4-6-11-18-31(19-12-7-5-2)29(37)32-20-21-33(27(23-32)28(35)36)30(38)34(25-15-9-8-10-16-25)26-17-13-14-24(3)22-26/h8-10,13-17,22,27H,4-7,11-12,18-21,23H2,1-3H3,(H,35,36) |
| InChIKey | JDWYBLDTKFOTBH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|