C34H50N6O4 — CID 86750500
(2R,4R)-2-N-[2-[(2-amino-2-oxoethyl)amino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide (PubChem CID 86750500) has the molecular formula C34H50N6O4 and a molecular weight of 606.81 g/mol. Its IUPAC name is (2R,4R)-2-N-[2-[(2-amino-2-oxoethyl)amino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide.
| Compound Name | (2R,4R)-2-N-[2-[(2-amino-2-oxoethyl)amino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide |
|---|---|
| PubChem CID | 86750500 |
| Molecular Formula | C34H50N6O4 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | (2R,4R)-2-N-[2-[(2-amino-2-oxoethyl)amino]ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperidine-1,2,4-tricarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H]1CCN(C(=O)N(c2ccccc2)c2ccccc2)[C@@H](C(=O)NCCNCC(N)=O)C1 |
| InChI | InChI=1S/C34H50N6O4/c1-3-5-13-22-38(23-14-6-4-2)33(43)27-19-24-39(30(25-27)32(42)37-21-20-36-26-31(35)41)34(44)40(28-15-9-7-10-16-28)29-17-11-8-12-18-29/h7-12,15-18,27,30,36H,3-6,13-14,19-26H2,1-2H3,(H2,35,41)(H,37,42)/t27-,30-/m1/s1 |
| InChIKey | OIUDTQFPVHQGHZ-POURPWNDSA-N |
| XLogP | 4.43 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|