C30H43BrN4O2 — CID 70084885
(2S)-2-(2-bromoethyl)-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,4-dicarboxamide (PubChem CID 70084885) has the molecular formula C30H43BrN4O2 and a molecular weight of 571.60 g/mol. Its IUPAC name is (2S)-2-(2-bromoethyl)-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,4-dicarboxamide.
| Compound Name | (2S)-2-(2-bromoethyl)-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 70084885 |
| Molecular Formula | C30H43BrN4O2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | (2S)-2-(2-bromoethyl)-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,4-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)N1CCN(C(=O)N(c2ccccc2)c2ccccc2)[C@@H](CCBr)C1 |
| InChI | InChI=1S/C30H43BrN4O2/c1-3-5-13-21-32(22-14-6-4-2)29(36)33-23-24-34(28(25-33)19-20-31)30(37)35(26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-18,28H,3-6,13-14,19-25H2,1-2H3/t28-/m0/s1 |
| InChIKey | FXGSXRWJQWIRCY-NDEPHWFRSA-N |
| XLogP | 7.52 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|